What is the condensed structural formula of cyclohexanol?
Cyclohexanol
| PubChem CID | 7966 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H12O or C6H11OH |
| Synonyms | CYCLOHEXANOL 108-93-0 Cyclohexyl alcohol Hexahydrophenol 1-Cyclohexanol More… |
What is the structure of 1 methyl cyclohexanol?
C7H14O
1-Methylcyclohexanol | C7H14O – PubChem.
What is the condensed structural formula of methanol?
Classification of Alcohols
| Condensed Structural Formula | Class of Alcohol | IUPAC Name |
|---|---|---|
| CH 3OH | — | methanol |
| CH 3CH 2OH | primary | ethanol |
| CH 3CH 2CH 2OH | primary | 1-propanol |
| (CH 3) 2CHOH | secondary | 2-propanol |
What is the Iupac name of cyclohexanol?
3,3-dimethyl cyclohexanol.
What is structural formula of cyclohexane?
C6H12
Cyclohexane/Formula
What is the condensed structural formula for 1 Methylcyclopentanol?
Identification of 1-Methylcyclopentanol Chemical Compound
| Chemical Formula | C6H12O |
|---|---|
| Molecular Weight | 100.15888 g/mol |
| IUPAC Name | 1-methylcyclopentan-1-ol |
| SMILES String | CC1(O)CCCC1 |
| InChI | InChI=1S/C6H12O/c1-6(7)4-2-3-5-6/h7H,2-5H2,1H3 |
What is the pKa value of cyclohexanol?
Structure for #
| Property | Value | Source |
|---|---|---|
| logS | -0.77 | ALOGPS |
| pKa (Strongest Acidic) | 18.18 | ChemAxon |
| pKa (Strongest Basic) | -1.4 | ChemAxon |
| Physiological Charge | 0 | ChemAxon |
What is the formula of methane?
CH₄
Methane/Formula
